Reaction Rates and Reversible Reactions: A Comprehensive

Analysis
Section 1: The Dynamics of Chemical Reactions: Understanding
Reaction Rates
The study of chemical reactions encompasses not only the transformation of
reactants into products but also the speed at which these transformations occur and
the extent to which they proceed. Reaction rates and the principles of reversible
reactions and chemical equilibrium are foundational to understanding and controlling
chemical processes, from laboratory-scale experiments to large-scale industrial
applications.

1.1 Defining and Measuring Reaction Rates

Chemical reactions exhibit a wide spectrum of speeds; some, like the precipitation of
barium sulphate when solutions of sodium sulphate and barium nitrate are mixed, are
virtually instantaneous, while others, such as the rusting of iron, occur very slowly
over extended periods.1 This inherent variability underscores the need for a
quantitative measure of reaction speed. The rate of a reaction is formally defined as
a measure of how much of the reactants are consumed or how much of the products
are formed per unit time.1

To determine the rate, an observable property that changes with time must be
monitored while all other conditions (like temperature and pressure) are kept
constant. Commonly monitored properties include a change in the mass of a reactant
or product, the volume of gas produced if one of the products is gaseous, or changes
in the intensity of colour if a reactant or product is coloured.1 For instance, the
progress of a reaction can be visualized by plotting the concentration of reactants
and products against time. Typically, the concentration of reactants decreases over
time, while the concentration of products increases, as illustrated in Figure 3.1 of the
source material.1

The selection of an appropriate experimental method to measure reaction rates is

crucial and depends on the specific characteristics of the reaction. If a reaction
evolves a gas, such as hydrogen from the reaction of magnesium with an acid, its
volume can be collected and measured over time using a gas syringe.1 If a reaction
involves a change in colour, spectrophotometric methods measuring absorbance can
be employed. For reactions where a solid is consumed in an open system and a gas
escapes, the change in mass of the reaction vessel and its contents can be tracked.1
This adaptability in experimental design is a key aspect of chemical kinetics.

The graphical representation of concentration versus time (as in Figure 3.1) reveals
that reaction rates are often not constant. The curves indicate that the rate,
represented by the slope of the curve, changes as the reaction proceeds. The rate
"per unit time" introduces a concept akin to a derivative in calculus for continuous
processes; the instantaneous rate at any point is the slope of the tangent to the
concentration-time curve at that point. Understanding reaction rates is of paramount
importance, particularly in industrial chemistry, where controlling these rates is
essential for optimizing production processes and ensuring efficiency.1

1.2 The Collision Theory and Activation Energy: The Energetic Basis of Reactions
For a chemical reaction to occur between reactant particles, they must first collide.
This fundamental requirement is a central tenet of the Collision Theory. However,
not every collision between reactant particles results in the formation of products.1
For a collision to be effective—that is, to lead to a chemical transformation—two main
conditions must be met: the colliding particles must possess a certain minimum
amount of kinetic energy, and they must collide with the correct orientation.

The minimum kinetic energy that colliding particles must possess for a reaction to
occur is termed the activation energy (Ea).1 This concept is visually represented by
an energy profile diagram (such as Figure 3.2 in the source material), where reactants
must overcome an energy barrier (the activation energy) to be converted into
products.1 The activation energy can be thought of as the energy required to break
existing bonds and/or to deform molecules to allow new bonds to form.

Activation energy serves as a kinetic barrier that dictates the speed of a reaction, and
it is distinct from the overall enthalpy change (ΔH) of the reaction, which determines
its thermodynamic favorability. A reaction might be highly exothermic
(thermodynamically favorable, with products at a much lower energy state than
reactants) but proceed very slowly if its activation energy is very high. In such cases,
only a small fraction of collisions will have sufficient energy to overcome this barrier,
resulting in a low rate of product formation.

While the source material primarily emphasizes the energy requirement for effective
collisions 1, the orientation of colliding particles is also critical, especially for reactions
involving complex molecules. For instance, if a molecule A-B is to react with C to form
A-C and B, C must collide with A in a specific orientation that facilitates the breaking
of the A-B bond and the formation of the A-C bond. A collision with incorrect
orientation, even if sufficiently energetic, will not lead to products.

The factors that influence reaction rates, which will be discussed subsequently,
primarily exert their effects by altering either the total frequency of collisions
between reactant particles or, more significantly, the fraction of these collisions that
possess energy equal to or greater than the activation energy.1 Understanding these
factors through the lens of collision theory and activation energy provides a powerful
framework for manipulating and controlling chemical reactions.

Section 2: Modulators of Reaction Velocity: Factors Influencing

Reaction Rates
The rate of a chemical reaction is not an immutable property but can be significantly
influenced by various external factors. These factors typically affect the frequency of
collisions between reactant particles or the energy associated with these collisions,
thereby altering the proportion of effective collisions that lead to product formation.

2.1 Concentration Effects: Impact of Reactant Abundance

The concentration of reactants plays a pivotal role in determining the rate of a
chemical reaction. Experiment 3.1, which investigates the reaction between
magnesium ribbon and varying concentrations of sulphuric(VI) acid, demonstrates
this effect clearly.1 In this experiment, four flasks (A, B, C, and D) were prepared with
sulphuric(VI) acid at concentrations of 2 M, 1.5 M, 1 M, and 0.5 M, respectively. It was
observed that the reaction, measured by the time taken for the magnesium ribbon to
completely disappear, was fastest in Flask A (highest concentration) and slowest in
Flask D (lowest concentration).1

The underlying mechanism for this observation is rooted in the Collision Theory. When
the concentration of reactant particles is high, there are more particles present per
unit volume. This increased particle density leads to a higher frequency of collisions
between the reactant molecules. With more collisions occurring per unit time, the
number of successful collisions (those possessing energy equal to or greater than the
activation energy) also increases, consequently leading to an increased rate of
reaction.1 A sample graph of concentration versus time, as depicted in Figure 3.3 of
the source material, qualitatively illustrates that reactions proceed faster at higher
initial concentrations.1

Further evidence for the impact of concentration is provided by Experiment 3.2, which
monitors the rate of hydrogen gas evolution from the reaction of magnesium with 0.5
M hydrochloric acid over time.1 The volume of gas produced was highest at the
beginning of the reaction and progressively slowed down as the reactants
(magnesium and hydrochloric acid) were consumed. This decrease in rate is a direct
consequence of the diminishing concentrations of the reactants as the reaction
proceeds, leading to fewer collisions and thus a slower rate of product formation.1
The graphical representation of gas volume versus time (Figure 3.5) shows a curve
whose slope (representing the rate) decreases with time.1

The rate of reaction can often be conveniently expressed as the reciprocal of the time
taken (1/t) for a specific observable change to occur (e.g., for all magnesium to react,
or for a certain amount of precipitate to form). A plot of 1/t against the concentration
of hydrochloric acid (as suggested by Figure 3.7) typically shows that the reaction
rate increases with increasing reactant concentration.1 It is important to recognize
that this relationship (Rate∝1/time) is most accurately applied when comparing the
time taken to reach the same extent of reaction under different conditions. The
concept of "average rate," calculated as the change in a property (e.g., volume of
gas) divided by the time interval, provides a useful approximation, though the
instantaneous rate, given by the tangent to the curve on a concentration-time graph,
offers a more precise measure at any given moment.1

2.2 Temperature Dependence: The Kinetic Energy Factor

Temperature has a profound effect on the rate of chemical reactions. Experiment 3.3
investigates this by examining the reaction between sodium thiosulphate and hydrochloric
acid at various temperatures (room temperature, 30°C, 40°C, 50°C, and 60°C). This reaction
is characterized by the formation of a yellow precipitate of sulphur:
Na2S2O3(aq)+2HCl(aq)⟶2NaCl(aq)+SO2(g)+H2O(l)+S(s).1
The time taken for the precipitate to obscure a cross marked on a piece of paper placed
beneath the reaction vessel is measured.
The experiment reveals that the time taken for the cross to become invisible is
shorter at higher temperatures, indicating that the reaction proceeds faster as the
temperature increases.1 An empirical rule of thumb often observed is that the rate of
reaction approximately doubles for every 10∘C rise in temperature.1 This significant
sensitivity is visualized in Figure 3.8 (time vs. temperature) and Figure 3.9 (1/t vs.
temperature), where the latter shows a clear increase in rate with temperature.1

The mechanism behind this temperature dependence is explained by the Collision

Theory. An increase in temperature leads to an increase in the average kinetic energy
of the reactant particles. Consequently, particles move faster, resulting in more
frequent collisions. More importantly, a rise in temperature significantly increases the
fraction of colliding particles that possess kinetic energy equal to or greater than the
activation energy (Ea) required for the reaction to occur. While the increase in
collision frequency contributes to the rate increase, the exponential increase in the
proportion of sufficiently energetic collisions is the dominant factor.1 Thus, more
effective collisions occur per unit time at higher temperatures, leading to a faster rate
of product formation.

The method of observing the time for a precipitate to obscure a mark, while simple,
can introduce subjectivity, as the precise moment the cross is deemed "invisible" may
vary between observers. This is a potential source of error in such experiments.1

Table 1 provides a summary of typical data from an experiment like 3.3, illustrating the
relationship between temperature and reaction rate.

Table 1: Illustrative Data for the Effect of Temperature on Reaction Rate (Based on
Experiment 3.3)
1

Temperature (°C) Time for Cross to be Rate (1/t, s−1)

Invisible (t, sec)

Room Temp (e.g., 20) 120 0.0083

30 60 0.0167

40 30 0.0333

50 15 0.0667

60 8 0.1250

This data clearly shows that as temperature increases, the time taken for the reaction
decreases, and consequently, the calculated rate (1/t) increases significantly.

2.3 Surface Area: Significance in Heterogeneous Systems

The surface area of reactants can significantly influence reaction rates, particularly in
heterogeneous reactions, where reactants are present in different phases (e.g., a solid
reacting with a liquid or a gas). Experiment 3.4 demonstrates this principle by comparing the
reaction of 1 M hydrochloric acid with 2.5 g of marble chips (calcium carbonate) versus 2.5 g
of powdered marble.1 The evolution of carbon(IV) oxide gas is measured to monitor the
reaction rate:
CaCO3(s)+2HCl(aq)⟶CaCl2(aq)+H2O(l)+CO2(g).1
Observations from this experiment show that the reaction with powdered marble
proceeds much faster than with marble chips. This is evident from the steeper slope
of the curve when plotting the volume of CO2 gas produced against time for the
powdered sample (as depicted in Figure 3.11).1 Both reactions, however, produce the
same total volume of gas, as this is determined by the initial mass of calcium
carbonate, which is identical in both cases.1

The mechanism explaining this effect is straightforward: grinding a solid substance

into a powder drastically reduces the particle size, which in turn greatly increases the
total surface area exposed for reaction. In heterogeneous reactions, the chemical
transformation occurs at the interface between the phases. A larger surface area
provides more sites for contact and collision between the reactant particles (in this
case, HCl molecules and the CaCO3 surface). With an increased area of contact, the
frequency of collisions increases, leading to a higher rate of effective collisions and
thus a faster overall reaction rate.1 This is why powdered marble reacts more
vigorously and reaches completion more quickly than marble chips. It is important to
reiterate that altering the surface area affects the rate of the reaction but not the
stoichiometry or the total yield of products, assuming the reactant in limited supply is
the solid itself.

2.4 Catalysis: Accelerating Reactions by Lowering Activation Energy

A catalyst is a substance that alters the rate of a chemical reaction without itself
being consumed or chemically changed by the end of the reaction.1 Catalysts achieve
this remarkable feat by providing an alternative reaction pathway with a lower
activation energy (Ea). This is illustrated in Figure 3.14, which compares the energy
profiles of a reaction with and without a catalyst; the overall enthalpy change (ΔH) of
the reaction remains unaffected.1

Experiment 3.5 investigates the catalytic effect of manganese(IV) oxide (MnO2) on the
decomposition of aqueous hydrogen peroxide (H2O2):
2H2O2(aq)⟶2H2O(l)+O2(g).1
The rate is monitored by measuring the volume of oxygen gas evolved.
At room temperature, the decomposition of hydrogen peroxide is very slow. However,
upon the addition of MnO2 powder, the reaction rate increases dramatically, and a
large volume of oxygen is collected in a much shorter time. A graph of oxygen volume
versus time (Figure 3.13) shows a significantly steeper curve for the catalysed
reaction compared to the uncatalysed one.1 Crucially, the mass of the MnO2
recovered at the end of the experiment is found to be the same as the initial mass,
confirming its role as a catalyst.1

By lowering the activation energy, a catalyst increases the number of reactant

particles that possess sufficient energy to react upon collision. This leads to a higher
frequency of effective collisions and, therefore, an accelerated reaction rate. Many
solid catalysts, like MnO2 in this experiment, are more effective when used in
powdered form because this increases their surface area, providing more active sites
for the reaction to occur.1

Catalysts exhibit specificity, meaning a particular catalyst will typically only accelerate
certain reactions or types of reactions. They do not alter the position of equilibrium in
reversible reactions (a concept discussed later); they merely increase the speed at
which equilibrium is attained by accelerating both the forward and reverse reactions
equally.

The industrial importance of catalysts is immense, as they enable many chemical

processes to occur at economically viable rates and under milder conditions (e.g.,
lower temperatures and pressures) than would otherwise be required. Table 2 lists
some common industrial catalysts and the processes they facilitate.

Table 2: Common Catalysts and Their Industrial Applications (Adapted from

Table 3.6 1)

Catalyst Industrial Process

Iron Manufacture of ammonia (Haber process)

Vanadium(V) oxide Manufacture of sulphuric acid (Contact

process)

Platinum Manufacture of nitric(V) acid

2.5 The Role of Light: Initiating Photochemical Reactions
Light, as a form of energy, can significantly influence the rate of certain chemical
reactions, known as photochemical reactions. It does so by energising specific
reactant particles, providing them with the necessary activation energy to react.1 This
increase in energised particles leads to a higher number of effective collisions per
unit time, thereby increasing the reaction rate.

Experiment 3.6 demonstrates the effect of light on the decomposition of silver

bromide (AgBr). Silver bromide, a pale yellow precipitate formed from the reaction of
potassium bromide and silver nitrate (KBr(aq)+AgNO3(aq)⟶AgBr(s)+KNO3(aq)), is
light-sensitive.1 In the experiment, portions of AgBr precipitate are exposed to
different light conditions: one in a dark cupboard, one on an open bench, and one in
direct sunlight. After a period, the sample in direct light shows the most significant
change, turning grey due to the decomposition of AgBr into metallic silver and
bromine. The sample on the bench shows some change, while the one in the dark
shows no noticeable change.1 This illustrates that the rate of decomposition is greater
with higher light intensity.

Several important reactions are photochemical in nature 1:

● Photography: The basis of traditional photography relies on the light-induced
decomposition of silver halides (like AgBr) coated on photographic film.
Processing is done in darkrooms to control this decomposition.
● Reaction between Chlorine and Hydrogen: While these gases do not react in
the dark at ordinary temperatures, exposure to UV light initiates an explosive
reaction to form hydrogen chloride: Cl2(g)+H2(g)UV light2HCl(g).
● Reaction between Bromine and Methane: The bromination of alkanes like
methane does not occur in darkness but proceeds rapidly in the presence of UV
light: CH4(g)+Br2(l)UV lightCH3Br(g)+HBr(g).
● Photosynthesis: This vital biological process in plants converts carbon(IV) oxide
and water into glucose (a sugar) and oxygen, using light energy absorbed by
chlorophyll: 6CO2(g)+6H2O(l)LightC6H12O6(aq)+6O2(g). (Note: The balanced
equation is provided here, correcting a typo in the source material 1).

In these reactions, light photons are absorbed by reactant molecules, exciting them
to a higher energy state where they are more reactive or can dissociate into reactive
intermediates (e.g., free radicals), thus initiating or accelerating the chemical
transformation. The intensity of light is a factor; higher intensity means more photons
are available to energise reactant particles, leading to a faster reaction rate, as
observed in Experiment 3.6.

2.6 Pressure Effects in Gaseous Reactions

Changes in pressure primarily affect the rates of reactions involving gaseous
reactants; reactions solely in the solid or liquid phase are largely unaffected by
pressure changes due to the incompressibility of these phases.1

For gaseous reactions, increasing the pressure—typically by compressing the gas

mixture and reducing its volume—brings the reactant particles closer together. This
effectively increases their concentration (number of particles per unit volume). As a
result of this increased proximity and concentration, the frequency of collisions
between the gaseous reactant particles increases. A higher collision frequency, in
turn, leads to a greater number of effective collisions per unit time, thereby increasing
the rate of the reaction.1

It is important to distinguish this effect of pressure on reaction rate from its effect on
the position of equilibrium in reversible gaseous reactions (which will be discussed in
Section 4.3). The impact on rate is fundamentally a concentration effect: higher
pressure means higher concentration of gaseous reactants, leading to faster kinetics.

Section 3: The Realm of Reversible Reactions and Chemical

Equilibrium
Not all chemical reactions proceed in a single direction to completion. Many are
capable of proceeding in both forward and reverse directions, leading to a state of
chemical equilibrium.

3.1 Reversible vs. Irreversible Reactions: A Fundamental Dichotomy

Chemical reactions can be broadly classified as either irreversible or reversible.1
An irreversible reaction is one that proceeds predominantly in one direction, and the products
formed cannot easily be converted back into the original reactants under the same
conditions. A common example is the combustion of paper to ash; the ash cannot be readily
transformed back into paper.1
In contrast, a reversible reaction is one that can proceed in both the forward and
backward directions. This means that the products of the forward reaction can react
with each other to re-form the original reactants.1 Reversible reactions are typically
represented by double arrows (⇌ or ⇔) in chemical equations. Many physical
changes, such as the interconversion of ice, liquid water, and steam, are reversible:
Ice⇔Water⇔Steam.1
A classic chemical example is the thermal dissociation of ammonium chloride (NH4Cl). When
solid NH4Cl is gently warmed, it decomposes into ammonia (NH3) gas and hydrogen chloride
(HCl) gas. On the cooler parts of the reaction vessel, these gases can recombine to form solid
NH4Cl again 1:
NH4Cl(s)⇔NH3(g)+HCl(g)
Experiment 3.7 provides another clear illustration with hydrated copper(II) sulphate (CuSO4
.5H2O).1 When blue crystals of hydrated copper(II) sulphate are heated, they lose their water
of crystallisation, forming white anhydrous copper(II) sulphate (CuSO4) and releasing water
as a colourless liquid (or vapour if heated strongly):
CuSO4.5H2O(s)heatCuSO4(s)+5H2O(l)
This process is reversible. If water is added back to the white anhydrous CuSO4, the blue
colour of the hydrated crystals is restored:
CuSO4(s)+5H2O(l)coolCuSO4.5H2O(s)
The overall reversible reaction is thus:
CuSO4.5H2O(s)cool⇌heatCuSO4(s)+5H2O(l).1
Other examples of reversible chemical reactions include the dehydration and
hydration of cobalt(II) chloride (CoCl2.6H2O(s) (pink)⇌CoCl2(s) (blue)+6H2O(g)) and
the reaction of iron with steam (3Fe(s)+4H2O(g)⇔Fe3O4(s)+4H2(g)).1 The key
characteristic is that the products can, under appropriate conditions, revert to
reactants. The conditions for the forward and reverse reactions often differ; for
instance, heating drives the dehydration of CuSO4.5H2O, while the presence of water
(and often cooling) promotes its rehydration. This ability to control the direction of
the reaction by altering conditions is a fundamental aspect of managing reversible
systems.

3.2 Dynamic Equilibrium: A State of Balanced Opposition

When a reversible reaction is carried out in a closed system—one from which no
reactants or products can escape—it can reach a state of dynamic equilibrium.1 This
state is not static; rather, it is a condition where the rate of the forward reaction
becomes exactly equal to the rate of the reverse reaction.

Consider the example of heating ammonium chloride in a sealed container: NH4Cl(s)⇌NH3(g)

+HCl(g).1
Initially, when NH4Cl is heated, only the forward reaction (decomposition) occurs at a
significant rate because the concentration of NH4Cl is high, and the concentrations of NH3
and HCl are zero. As NH3 and HCl are produced, the reverse reaction (recombination of NH3
and HCl to form NH4Cl) begins. The rate of this reverse reaction increases as the
concentrations of NH3 and HCl build up. Simultaneously, the concentration of NH4Cl
decreases, causing the rate of the forward reaction to slow down.
Eventually, a point is reached where the rate of decomposition of NH4Cl becomes
equal to the rate of formation of NH4Cl from NH3 and HCl. At this juncture, the
system is in dynamic equilibrium.1 Macroscopically, it appears as though the reaction
has stopped because the concentrations of all reactants and products remain
constant. However, at the molecular level, both forward and reverse reactions
continue to occur at the same speed, resulting in no net change in the amounts of
substances present.1 The term "dynamic" emphasizes this ongoing molecular activity.
The symbol ⇌ is specifically used to denote a system at equilibrium.

The critical requirement for attaining chemical equilibrium is a closed system. If

products were allowed to escape (e.g., if NH3 and HCl gases could leave an open
container), their concentrations would remain low, preventing the reverse reaction
rate from matching the forward rate, and the reaction might proceed to completion in
one direction. At equilibrium, while rates are equal, the concentrations of reactants
and products are constant but not necessarily equal to each other. Their relative
proportions are determined by the equilibrium constant (K) for the reaction at that
specific temperature.

Experiment 3.8, involving an acid-base indicator, provides a visual demonstration of dynamic

equilibrium.1 An indicator (HIn) exists in equilibrium with its ions:
HIn(aq)⇌H+(aq)+In−(aq)
The colours of HIn and In− are different. If a base (e.g., NaOH) is added, OH− ions react with
H+ ions, reducing their concentration. According to Le Chatelier's principle (discussed next),
the equilibrium shifts to the right to produce more H+ (and In−), causing a colour change.
Conversely, adding an acid increases H+ concentration, shifting the equilibrium to the left,
and again resulting in a colour change. This demonstrates how an equilibrium system
responds to disturbances by shifting to re-establish a balance, highlighting its dynamic
nature.
Section 4: Perturbing Equilibrium: Le Chatelier's Principle in
Action
Once a reversible reaction has attained a state of dynamic equilibrium, this balance
can be disturbed by changes in external conditions such as concentration, pressure
(for gaseous systems), or temperature. The system's response to such disturbances
is qualitatively predicted by Le Chatelier's Principle.

4.1 Le Chatelier's Principle: Predicting Equilibrium Shifts

Le Chatelier's Principle states: "When a change in conditions is applied to a
system in equilibrium, the system moves so as to oppose that change.".1 This
principle provides a powerful qualitative tool for predicting the direction in which an
equilibrium will shift when subjected to an external stress. The "opposition" means the
system will adjust to a new equilibrium position in a way that partially counteracts the
imposed change, rather than completely nullifying it.

4.2 Impact of Concentration Changes

Altering the concentration of any reactant or product in an equilibrium mixture will
cause the equilibrium to shift in a direction that tends to reduce the effect of that
change.1

Experiment 3.9 illustrates this with bromine water. The equilibrium in bromine water can be
represented as:
Br2(aq) (yellow-orange)+H2O(l)⇌OBr−(aq)+Br−(aq)+2H+(aq) (where OBr− and Br− contribute
to a colourless solution).1
● Adding Sodium Hydroxide (NaOH): NaOH provides OH− ions, which react with
H+ ions in the equilibrium mixture, effectively removing H+. To counteract this
decrease in [H+], the equilibrium shifts to the right, producing more H+ (along
with OBr− and Br−). This consumes Br2, causing the yellow-orange colour to fade
and the solution to become colourless.1
● Adding Hydrochloric Acid (HCl): HCl increases the concentration of H+ ions. To
counteract this increase, the equilibrium shifts to the left, consuming H+ (along
with OBr− and Br−) to form more Br2. This results in an intensification of the
yellow-orange colour.1

A similar effect is observed in the chromate/dichromate equilibrium:

2CrO42−(aq) (yellow)+2H+(aq)⇌Cr2O72−(aq) (orange)+H2O(l).1
Adding acid (increasing [H+]) shifts the equilibrium to the right, favoring the formation of
orange dichromate ions. Adding a base (which removes H+ ions) shifts the equilibrium to the
left, favoring the formation of yellow chromate ions.
In general, for a reaction A(aq)+B(aq)⇌C(aq)+D(aq):
● Increasing the concentration of a reactant (e.g., B) will shift the equilibrium to the
right (consuming B).
● Increasing the concentration of a product (e.g., D) will shift the equilibrium to the
left (consuming D).1
● Decreasing the concentration of a reactant will shift it left.
● Decreasing the concentration of a product (e.g., by removal) will shift it right.

This shift occurs because the change in concentration temporarily unbalances the
rates of the forward and reverse reactions. The system then adjusts the
concentrations of all species until the rates become equal again at a new equilibrium
position. The continuous removal of a product is a common industrial tactic to drive a
reversible reaction towards higher product yield.

4.3 Influence of Pressure on Gaseous Equilibria

Changes in pressure primarily affect equilibria that involve gaseous reactants and/or
products, and where there is a change in the total number of moles of gas during the
reaction.1 Pressure changes have negligible effects on equilibria involving only solids
or liquids due to their low compressibility.

According to Le Chatelier's Principle, if the pressure of a gaseous system at

equilibrium is increased, the equilibrium will shift in the direction that results in fewer
moles of gas, thereby reducing the pressure. Conversely, if the pressure is
decreased, the equilibrium will shift in the direction that produces more moles of gas.1

Consider the equilibrium between nitrogen(IV) oxide (NO2) and dinitrogen tetroxide (N2O4):
2NO2(g) (dark brown, 2 moles)⇌N2O4(g) (pale yellow, 1 mole).1
If this mixture is in a syringe and the piston is pushed in (increasing pressure), the equilibrium
shifts to the right, favoring the formation of N2O4 (1 mole) from 2NO2 (2 moles). This shift
reduces the total number of gas molecules, thus counteracting the applied pressure
increase, and the mixture becomes paler yellow. If the piston is withdrawn (decreasing
pressure), the equilibrium shifts to the left, favoring the formation of more NO2, and the
mixture darkens.1
If a reaction involves no change in the total number of moles of gas (e.g., H2(g)+I2
(g)⇌2HI(g), where 2 moles of gas react to form 2 moles of gas), a change in pressure
will not affect the position of equilibrium. However, increasing the pressure might
increase the rate at which equilibrium is attained due to increased concentrations.1

Table 3 summarizes the effect of pressure changes on various gaseous equilibria.

Table 3: Summary of Pressure Effects on Gaseous Equilibria (Adapted from

Table 3.7 1)

Reaction Moles of Gas Effect of Increased Effect of Decreased

(Reactants → Pressure Pressure
Products)

N2O4(g)⇌2NO2(g) 1 mol → 2 mol Shifts Left (more N2 Shifts Right (more

O4) NO2)
 N2(g)+3H2(g)⇌2NH3 4 mol → 2 mol Shifts Right (more Shifts Left (more
(g) NH3) reactants)

2SO2(g)+O2 3 mol → 2 mol Shifts Right (more Shifts Left (more

(g)⇌2SO3(g) SO3) reactants)

4NH3(g)+5O2 9 mol → 10 mol Shifts Left (more Shifts Right (more

(g)⇌4NO(g)+6H2O(g) reactants) products)

H2(g)+Cl2 2 mol → 2 mol No effect on position No effect on position

(g)⇌2HCl(g)

4.4 Temperature Effects on Equilibrium Position

Temperature changes affect the position of equilibrium by favoring either the
endothermic or exothermic direction of the reversible reaction.1

Experiment 3.10 investigates the temperature effect on the N2O4(g)⇌2NO2(g) equilibrium.

The NO2 gas is initially produced by the reaction of copper with concentrated nitric acid:
Cu(s)+4HNO3(l)⟶Cu(NO3)2(aq)+2NO2(g)+2H2O(l).1 The equilibrium is often written as:
N2O4(g) (pale yellow)cool⇌heat2NO2(g) (dark brown).1
The placement of "heat" above the forward arrow (or implied by heating causing the forward
reaction) indicates that the forward reaction (dissociation of N2O4 into 2NO2) is endothermic
(absorbs heat). Consequently, the reverse reaction (formation of N2O4 from 2NO2) is
exothermic.
Observations from Experiment 3.10 are 1:
● Cooling the mixture: The colour of the gas changes from brown towards pale
yellow. This indicates a shift to the left, favoring the formation of N2O4. This is
consistent with the reverse reaction being exothermic (cooling favors the heat-
releasing direction).
● Warming the mixture: The colour turns a darker brown. This indicates a shift to
the right, favoring the formation of NO2. This is consistent with the forward
reaction being endothermic (heating favors the heat-absorbing direction).

According to Le Chatelier's Principle:

● Increasing the temperature of a system at equilibrium will cause the equilibrium
to shift in the direction that absorbs heat (the endothermic direction).
● Decreasing the temperature will cause the equilibrium to shift in the direction
that releases heat (the exothermic direction).

Temperature is unique among these factors because it is the only one that changes
the value of the equilibrium constant (K) for a reaction. While changes in
concentration or pressure shift the equilibrium position to maintain the value of K (at
constant temperature), a change in temperature alters K itself. For an endothermic
reaction, K increases with increasing temperature; for an exothermic reaction, K
decreases with increasing temperature.

Table 4 summarizes the effect of temperature changes on equilibrium.

Table 4: Summary of Temperature Effects on Equilibrium (Adapted from Table

3.8 1)

Type of Reaction ΔH Effect of Increased Effect of Decreased

(Forward) Temperature Temperature

Exothermic Negative Shifts Left (favors Shifts Right (favors

reactants) products)

Endothermic Positive Shifts Right (favors Shifts Left (favors

products) reactants)

4.5 Catalysts and Their Non-Effect on Equilibrium Position

A catalyst increases the rate of a chemical reaction by lowering the activation energy.
However, a catalyst has no effect on the position of equilibrium.1 It only alters the
rate at which equilibrium is attained.1

Catalysts achieve this by lowering the activation energy for both the forward and the
reverse reactions by the same amount. Consequently, they speed up both the
forward and reverse reactions equally. While the system reaches equilibrium much
faster in the presence of a catalyst, the relative concentrations of reactants and
products at equilibrium remain unchanged. The equilibrium constant (K) is also
unaffected by the presence of a catalyst.

Section 5: Equilibrium Principles in Industrial Chemistry:

Optimizing Production
The principles of chemical equilibrium, particularly Le Chatelier's Principle, are
extensively applied in industrial chemical processes to maximize the yield of desired
products efficiently and economically. Manufacturers aim to achieve optimum
conditions—the specific set of temperature, pressure, and catalyst use that provides
the highest possible yield in the shortest time and at the minimum cost.1 This often
involves manipulating equilibrium positions by removing products or carefully
selecting reaction conditions.

5.1 The Haber Process: Ammonia Synthesis

The Haber Process (or Haber-Bosch Process) is the industrial synthesis of ammonia (NH3)
from nitrogen gas (N2) and hydrogen gas (H2). This process is crucial for the production of
fertilizers and other nitrogen-containing compounds. The reaction is reversible and
exothermic 1:
N2(g)+3H2(g)⇌2NH3(g)ΔH=−92 kJ mol−1
The choice of optimum conditions is a careful balance of kinetic and equilibrium
considerations 1:
● Temperature: Since the forward reaction (ammonia formation) is exothermic, Le
Chatelier's Principle predicts that low temperatures would favor a higher yield of
NH3. However, at low temperatures, the reaction rate is impractically slow.
Conversely, high temperatures increase the rate but decrease the equilibrium
yield. Therefore, a compromise or optimum temperature of about 450°C is
used. This temperature provides a reasonable reaction rate while still allowing for
an acceptable equilibrium yield of ammonia.
● Pressure: The forward reaction involves a decrease in the number of gas
molecules (4 moles of reactants produce 2 moles of product). According to Le
Chatelier's Principle, increasing the pressure will shift the equilibrium to the right,
favoring the formation of more NH3. High pressure also increases the reaction
rate by increasing the concentration of gaseous reactants. However, building and
maintaining high-pressure industrial plants is expensive and poses engineering
challenges. An optimum pressure of around 200 atmospheres is typically
employed, balancing yield enhancement and cost.
● Catalyst: An iron catalyst (often with promoters) is used to increase the rate at
which equilibrium is attained. The catalyst does not affect the equilibrium position
or the yield of ammonia at equilibrium, but it allows the reaction to reach that
equilibrium much faster, making the process economically viable. While platinum
is a more effective catalyst, it is significantly more expensive and susceptible to
 poisoning by impurities in the reactant gases.1
● Removal of Product: To further drive the equilibrium towards ammonia
production, the NH3 formed is continuously removed from the reaction mixture
(usually by cooling and liquefaction). This decrease in product concentration
causes the equilibrium to shift to the right, encouraging more N2 and H2 to react
to replace the removed ammonia, thereby increasing the overall conversion.1
Unreacted nitrogen and hydrogen are typically recycled back into the reactor.

5.2 The Contact Process: Sulfuric Acid Manufacture

The Contact Process is the primary industrial method for producing sulfuric acid (H2SO4). A
key reversible and exothermic step in this process is the catalytic oxidation of sulfur(IV) oxide
(SO2) to sulfur(VI) oxide (SO3) 1:
2SO2(g)+O2(g)⇌2SO3(g)ΔH=−197 kJ mol−1
The selection of optimum conditions for this stage also reflects a balance between
equilibrium yield and reaction rate 1:
● Temperature: The forward reaction is highly exothermic. Thus, low temperatures
would favor a higher equilibrium yield of SO3. However, as with the Haber
process, low temperatures lead to a slow reaction rate. An optimum
temperature of about 450°C is used to achieve a good balance between a high
conversion rate and a sufficiently fast reaction.
● Pressure: The forward reaction results in a decrease in the number of gas
molecules (3 moles of reactants produce 2 moles of product). Therefore, high
pressure would favor the formation of more SO3. However, in practice, the
Contact Process is often operated at or near atmospheric pressure. Even at this
pressure, a high percentage conversion of SO2 to SO3 (around 96%) can be
achieved with the use of a catalyst.1 This suggests that the equilibrium is already
quite favorable under these temperature conditions, and the additional cost and
complexity of high-pressure equipment may not be justified for the marginal
increase in yield.
● Catalyst: Vanadium(V) oxide (V2O5) is used as the catalyst. It significantly
increases the rate of the reaction, allowing the desired high conversion to be
achieved efficiently.1

In both the Haber and Contact processes, the application of Le Chatelier's principle,
combined with an understanding of reaction kinetics and economic factors, dictates
the choice of operating conditions. The goal is always to maximize product yield in
the most cost-effective and timely manner. The continuous removal of product in the
Haber process and the high intrinsic favorability of SO3 formation in the Contact
process (even at atmospheric pressure) are key strategies leveraging equilibrium
principles.

Section 6: Concluding Perspectives on Reaction Kinetics and

Equilibrium
The exploration of reaction rates and reversible reactions reveals fundamental
principles that govern how chemical transformations occur and the extent to which
they proceed. These concepts, namely chemical kinetics (the study of reaction rates
and mechanisms) and chemical equilibrium (the study of the balance in reversible
reactions), are inextricably linked and form two of the cornerstones of physical
chemistry.

The rate of a chemical reaction is dictated by factors such as reactant

concentrations, temperature, physical state (surface area for solids), pressure (for
gases), and the presence of catalysts. These factors influence the frequency and
effectiveness of collisions between reactant particles, as described by the Collision
Theory, and the ability of these particles to overcome the activation energy barrier.1
Understanding these influences allows chemists to control and manipulate the speed
of reactions.

Many chemical reactions do not proceed to completion in one direction but are
reversible, meaning products can react to re-form reactants. In a closed system, such
reactions can attain a state of dynamic equilibrium, where the rates of the forward
and reverse reactions are equal, and the net concentrations of reactants and
products remain constant.1 Le Chatelier's Principle provides a qualitative framework
for predicting how a system at equilibrium will respond to changes in concentration,
pressure, or temperature, by shifting in a direction that counteracts the applied
stress.1 Catalysts, while crucial for accelerating the attainment of equilibrium, do not
alter the equilibrium position itself.1

The interplay between kinetics and equilibrium is critical. A reaction may be

thermodynamically very favorable (i.e., the equilibrium lies far to the product side),
but if its activation energy is very high, it may proceed at an imperceptibly slow rate
without a catalyst or elevated temperatures. Conversely, a reaction might be
kinetically fast but have an unfavorable equilibrium position, resulting in low product
yield. The optimization of industrial processes, such as the Haber synthesis of
ammonia and the Contact process for sulfuric acid, exemplifies the practical
application of these principles. Conditions are carefully chosen to strike a balance
between achieving a favorable equilibrium yield and ensuring an economically viable
reaction rate.1

The significance of reaction rates and equilibrium extends far beyond industrial
chemistry. These concepts are vital in understanding environmental processes, such
as the formation and degradation of pollutants or the balance of gases in the
atmosphere and oceans. In biological systems, enzyme catalysis and the intricate
network of metabolic pathways are governed by highly specific reaction rates and
carefully maintained equilibria, essential for life. Thus, a thorough grasp of the
dynamics of chemical change and the nature of chemical balance is indispensable for
a comprehensive understanding of the chemical world.

Works cited

1. SECONDARY CHEMISTRY FORM [Link]