0% found this document useful (0 votes)
25 views8 pages

Overview of Monohydric Alcohols

The document provides information about monohydric alcohols including their general formula, common naming conventions, IUPAC rules for naming alcohols, classification as primary, secondary or tertiary alcohols, methods of preparation including Grignard reactions and reductions, physical and chemical properties, terminology used to describe alcohol concentration, and common uses of methanol and ethanol. It also discusses polyhydric alcohols such as ethylene glycol, propylene glycol, and glycerol.

Uploaded by

sam cuadra
Copyright
© All Rights Reserved
We take content rights seriously. If you suspect this is your content, claim it here.
Available Formats
Download as PDF, TXT or read online on Scribd
0% found this document useful (0 votes)
25 views8 pages

Overview of Monohydric Alcohols

The document provides information about monohydric alcohols including their general formula, common naming conventions, IUPAC rules for naming alcohols, classification as primary, secondary or tertiary alcohols, methods of preparation including Grignard reactions and reductions, physical and chemical properties, terminology used to describe alcohol concentration, and common uses of methanol and ethanol. It also discusses polyhydric alcohols such as ethylene glycol, propylene glycol, and glycerol.

Uploaded by

sam cuadra
Copyright
© All Rights Reserved
We take content rights seriously. If you suspect this is your content, claim it here.
Available Formats
Download as PDF, TXT or read online on Scribd

Week 8

Monohydric Alcohols
Alcohol is an organic compound in which an —OH group is bonded to a saturated carbon
atom. The word alcohol immediately brings to mind ethanol, the intoxicating compound in
wine and beer. Naturally occurring alcohols include 2-phenylethanol, the compound
responsible for the intoxicating smell of rose;
General Formula: R-OH (OH is functional group)
Examples: CH3OH, C3H7OH
Common Names for Alcohol:
1. Name all of the carbon atoms of the molecule as a single alkyl group.
Example: Methyl (C1), Ethyl (C2), propyl (C3) butyl (C4)
2. Add the word alcohol, separating the worlds with a space.
Example: methyl alcohol
IUPAC Rules for Naming Alcohols:
Rule 1: Name the longest carbon chain to which the hydroxyl group is attached. The
chain name is obtained by dropping the final “-e” from the alkane name and adding the
suffix “-ol.”
Rule 2: Number the chain starting at the end nearest the hydroxyl group, and use the
appropriate number to indicate the position of the —OH group. (In numbering of the
longest carbon chain, the hydroxyl group has priority over double and triple bonds, as
well as over alkyl, cycloalkyl, and halogen substituents.)
Rule 3: Name and locate any other substituents present.
Rule 4: In alcohols where the —OH group is attached to a carbon atom in a ring, the
hydroxyl group is assumed to be on carbon 1.
Classification of Alcohols
Alcohols are classified as primary (1o), secondary (2o), or tertiary (3o) alcohols
1. Primary alcohol (1o): Hydroxyl-bearing carbon atom is bonded to only one other carbon
atom.
2. Secondary alcohol (2o): Hydroxyl bearing carbon atom is bonded to two other carbon
atoms.
3. Tertiary alcohol (3o): Hydroxyl-bearing carbon atom is bonded to three other carbon
atoms.
Preparation of Alcohols
A. General Preparation
1. Grignard reagent w/ formaldehyde and water
CH3MgCl + HCHO 🡪 CH3CH2O MgCl + H2O 🡪 CH3CH2OH + Mg(OH)Cl
2. Grignard reagent w/ any other aldehyde and water
CH3MgCl + CH3CHO 🡪 CH3CH(CH3)O MgBr + H2O 🡪 CH3CH(CH3)(OH) +
Mg(OH)Br
3. Grignard reagent w/ ketone and water
CH3MgCl + CH3C(CH3)(O) 🡪 CH3C(CH3)OMgI + H2O 🡪 C(CH3)3 (OH) +
Mg(OH)I
4. Reduction of aldehyde
CH3CH2CHO + H2 🡪 CH3CH2CH2OH
5. Reduction of ketone
CH3CH2COCH3 + H2 🡪 CH3CH2C(OH)(CH3)
6. Reduction of organic acid
CH3CH2CH2COOH + H2 🡪 CH3CH2CH2COOH + H2 🡪 CH3CH2CH2CH2OH + HOH
B. Specific Preparation
Methanol or Methyl Alcohol
1. Dry distillation of wood
2. Reaction of CO + H2 in the presence of Zn-CrO3 at 4000C and 150 atm
CO + H2 🡪 HCHO + CH3OH
Ethanol or Ethyl Alcohol
1. Fermentation of black strap molasses
2. Fermentation of starch in corn, sugar beets, grain, potatoes and rice – grain alcohol
3. Hydration of ethylene with H2SO4 as catalyst
CH2=CH2 + H2O 🡪 CH3CH2OH
Physical Properties of Alcohols
1. Lower alcohols (C1 to C4) are colorless, volatile liquid.
2. Middle members (C5 to C11) are odorless, colorless, waxy solids.
3. Lower alcohols have a penetrating pleasant smell
4. Higher alcohols have flowery odors while the rest are odorless solids.
5. Lower alcohols are soluble in water
6. Middle member alcohols show slight solubility in water
7. Lower alcohols are mobile liquids with low boiling point.
8. All alcohols are neutral in reaction, flammable, burning with a blue flame, forming
carbon dioxide and water.
9. Alcohols have higher boiling points than alkanes of similar molecular mass.
10. Alcohols have much higher solubility in water than alkanes of similar molecular
mass.
11. The boiling points of 1-alcohols with an OH group on an end carbon increases as the
length of the carbon chain increases.

Chemical Properties of Alcohols


1. Replacement of H of the OH with the following forming salt
a. Metal more active than hydrogen in the activity series.
2 CH3CH2CH2OH + 2Na 🡪 2CH3CH2CH2ONa + H2
b. Metal oxide
2CH3CH2OH + CaO 🡪 Ca( CH3CH2O)2
c. Base
CH3CH2OH + NaOH 🡪 CH3CH2ONa + H2O
d. Salt
CH3CH2CH2OH + KCl 🡪 CH3CH2CH2OK + HCl
2. Replacement of the OH with the following
a. With PCl3
3 CH3CH2CH2OH + PCl3 🡪 3 CH3CH2CH2Cl + H3PO3
b. PCl5
CH3CH2OH + PCl5 🡪 CH3CH2Cl + POCl3 + HCl

c. SOCl2
CH3OH + SOCl2 🡪 CH3Cl + SO2 + HCl
d. Halogen acid
CH3CH2OH + HBr 🡪 CH3CH2Br + H2O
3. Dehydration at various temperature
a. At 180 0C – alkene is formed
CH3CH2OH 1800C 🡪 CH2 = CH2 + H2O
b. At 1400C – ether is formed
CH3CH2OH + CH3CH2OH 1400C 🡪 CH3CH2OCH2 CH3 + H 2O
c. Oxidation
[Link] Primary Alcohols with acid-dichromate
CH3CH2CH2OH + O 🡪 CH3CH2CHO + H2O
[Link] Secondary Alcohols with acid-dichromate
CH3CHOHCH3 + O 🡪 CH3COCH3 + H2O
3. With Tertiary Alcohols with acid-dichromate
C(CH3)3(OH) + O 🡪 no reaction
4. Combustion
CH3CH2OH + 3 O2 🡪 2CO2 + 3H 2O
Terminology of Alcohols
1. Cooling solution – 30%
2. To prevent bedsores- 50%
3. Antiseptic- 70%
4. Removes pain in neuralgia- 80%
5. Refined alcohol – 95%
6. Absolute alcohol – 99.5%
7. Denatured alcohol-alcohol unfit for human consumption, made by the addition of various
denaturants.
8. Proof Spirit- expression of alcohol concentration in % by volume
Uses
A. Methanol or Methyl Alcohol
1. Used in the production of celluloid, gum, cotton, and nitrocellulose products.
2. Used in the manufacture of anti-freeze and formaldehyde.
3. Used to denature grain alcohol.
4. Used for the aeration of rocket fuel
5. Used as solvent for organic compounds like varnish, paints and adhesives.
6. Good fuel and used as a solvent in paints
B. Ethanol or Ethyl Alcohol
1. Mild stimulant in alcoholic beverages. It serves to allay anxiety and distress,
shock or sudden lowering of blood pressures.
2. A mild 30% solution gives a cooling solution, 50% solution prevents bedsores
and 70% solution is used as antiseptic
3. Used as antidote for carbolic poisoning and burns.
4. Solvent and extractive medium and reagent in various organic substances such as
cosmetics, pharmaceuticals, and explosives.
5. Used as raw materials for the synthesis of many organic substances such as
acetaldehyde, acetic acid and ethyl chloride.
6. Strong 80% injected into the ganglia removes pains in neuralgia leading to
degeneration of nerve fibers and paralysis of sensation.
Alcohols with More Than One Hydroxyl Group
[Link] Glycol (1,2-Ethanediol) and Propylene Glycol (1,2-Propanediol)
a. A diol with two -OH groups attached on two adjacent carbon atoms.
b. Colorless, odorless, miscible in water, great antifreeze, airplane deicer.
c. Extremely toxic.
d. Glycol is a hygroscopic liquid with a sweet taste.
e. It is miscible in water and alcohol but slightly soluble in ether
f. Glycols are more reactive than monohydric alcohols.

Uses of Glycol
1. It is used in the plastic industry.
2. Used as a preservative.
3. Used as a solvent
[Link] (1,2,3-Propanetriol)
a. Glycerol is a triol with three -OH groups attached on three adjacent carbon atoms.
b. Clear thick liquid
c. It is a byproduct of fat metabolism
d. Used in skin lotions and soaps
e. Used in shaving creams due to lubricating properties
f. Often called biological antifreeze
Uses of Glycerol
1. In tobacco products, it is used for aromatizing, softening agent, and in maintaining
moisture content.
2. It is used in the manufacture of nitroglycerine and dynamite.
3. It is used in the production of synthetic resins and ester gums.
4. It is used as ingredients in pharmaceutical products.
5. In foods, when used in peanut butter, it prevents separation of the oil and flavor; adds in
baked goods, it helps retain freshness.
6. In cosmetics, it serves as plasticizer.
7. It imparts softness and flexibility to cellulose films and meat casings.
8. When ingested in foods, it is nutritious and is easily digested.
9. In the form of glyceryl monostereate, it is the basic ingredient in ice cream stabilizer
Exercise No. 6
Monohydric Alcohols

1. Name the following alcohols:

____________________a. CH3CH2CH2CH2OH

____________________b. CH3CH2CH2CH2(OH)CH2CH3

____________________c. CH3CH2CH(OH)CH2CH(CH3)CH3

____________________d. CH3C(OH)(CH3)CH2CH2CH3

2. Prepare pentanol by using the following methods:

a. reduction method from aldehydes

b. Grignard’s synthesis

3. Show the reduction of pentylbromide

a. Reduction method from ketones

b. Grignard’s synthesis
4. show the chemical reaction of the following:

a. reduction method from aldehydes

b. Grignard’s synthesis

5. What is denatured alcohol?

6. How is absolute alcohol prepared?

7. What are the effects of ethyl alcohol to babies born from alcohol parents?
Exercise No. 7
Polyhydric Alcohols

1. Name the following:

___________________a. CH3CHOHCH2OH

___________________b. CH2OH CH2CHOHCH3

2. Write chemical equation to show how hydrogen chloride can react with glycerol to yield the
following:

a. glycerol chlorohydrins

b. 1, 2, 3 trichloropropane

3. Apply the reaction for the oxidation of glycols by potassium permanganate and by lead
tetraacetate to the following glycols.

a. 2, 3 butanediol

b. 1, 2 propanediol

1. Explain the fact that 1,5 – pentanediol is soluble in water compared to 1- pentanol.

Common questions

Powered by AI

Ethanol consumption can have various health implications, particularly when consumed in large quantities, leading to addiction, liver disease, and mental impairments. From an environmental perspective, while ethanol is touted as a cleaner alternative energy source due to its lower emission rates compared to fossil fuels, its large-scale production can lead to deforestation, resource depletion, and changes in land use that impact biodiversity. Industrially, ethanol's antiseptic and solvent properties make it invaluable, but mishandling can pose health risks, such as from inhalation or prolonged exposure, necessitating strict regulations to minimize potential risks .

Methanol is widely used in the production of formaldehyde and as an antifreeze component, and it serves to denature ethanol. It plays a crucial role as a solvent for organic compounds and as a fuel for vehicles. Ethanol's industrial uses are extensive: it acts as a solvent in pharmaceuticals, cosmetics, and is used in alcoholic beverage production; it is also employed as a disinfectant due to its antiseptic properties. Ethanol is additionally involved in the synthesis of organic chemicals such as acetaldehyde, acetic acid, and ethyl chloride, showcasing its versatility .

The chemical properties of alcohols, specifically their flammability and combustion byproducts, make them significant candidates for energy production. When burned, they produce carbon dioxide and water, releasing significant amounts of energy, making them suitable for use as fuels. Methanol and ethanol are often described as cleaner-burning fuels than fossil fuels due to the lower emissions of particulates and sulfur compounds. Additionally, their ability to blend with traditional fuels offers increased octane levels and reduced emissions, critical benefits in alternative energy solutions .

Alcohols showcase significant reactivity in replacement reactions with metals and non-metals. When reacted with active metals, they form alkoxides and hydrogen gas, illustrating their acidic character when the hydrogen from the hydroxyl group is replaced, as seen with sodium forming sodium alkoxide. Alcohols can also replace the hydroxyl group with halogens using reagents such as PCl3 or SOCl2, which demonstrates nucleophilic substitution characteristics. These reactions highlight alcohols' ability to act as acids in forming organic salts and as substrates for nucleophilic attacks .

The IUPAC naming system for monohydric alcohols involves identifying the longest carbon chain with the hydroxyl group attached, dropping the '-e' from the corresponding alkane name, and adding the suffix '-ol'. The numbering begins from the end nearest to the hydroxyl group. Conversely, the common naming system treats the entire carbon atom sequence as a single alkyl group followed by the word 'alcohol', suffixed by space instead of numerical positioning, e.g., 'methyl alcohol' versus IUPAC’s 'methanol' .

As the carbon chain length of alcohols increases, their boiling points generally rise. This trend is attributed primarily to the increased van der Waals (dispersion) forces due to greater molecular masses, which demand more energy for molecules to escape the liquid phase. The hydroxyl group also participates in extensive hydrogen bonding, strengthening intermolecular interactions, thus increasing the energy required to separate molecules into a gas phase. This results in progressively higher boiling points with elongating carbon chains, alongside increased miscibility challenges in polar solvents due to structural bulkiness .

Alcohols, particularly methanol and ethanol, serve as versatile solvents across various industries due to their ability to dissolve a wide range of chemical substances. Methanol is often used in the production of varnishes, paints, and adhesives, while ethanol serves in pharmaceuticals and cosmetics production, functioning as an extractive medium for active components and an ingredient in many formulations. Their polar nature and ability to form hydrogen bonds make them especially effective in dissolving compounds that are either slightly non-polar or polar, making these alcohols indispensable in the manufacture of plastics, coatings, and medical formulations .

Polyhydric alcohols, such as glycols and glycerol, are more reactive than monohydric alcohols owing to the presence of multiple hydroxyl groups. This multiple -OH groups increase the sites available for reactions such as esterification and oxidation. These additional hydroxyl groups significantly enhance their hydrophilicity, thus making them highly miscible with water and alcoholic solvents while also influencing their boiling points due to enhanced hydrogen bonding. This increased reactivity allows for more complex chemical syntheses, including in industrial applications like polymer production where hydroxyl groups are integral in forming esters and ethers .

Monohydric alcohols have a hydroxyl group (-OH) which is responsible for hydrogen bonding, a factor that greatly enhances their boiling points and solubility in water compared to alkanes of similar molecular mass, which lack the hydrogen bonding potential. As a result, alcohols showcase higher boiling points due to the energy required to break these bonds and exhibit greater solubility because the -OH group can interact with water molecules, a property distinct from hydrocarbons which are non-polar .

The synthesis of alcohols using Grignard reagents varies depending on the carbonyl compound involved. When reacting a Grignard reagent with formaldehyde, a primary alcohol is produced. Reaction with other aldehydes yields secondary alcohols due to the addition of a carbon group from the Grignard reagent. In the presence of ketones, tertiary alcohols are synthesized, as the carbon atom that the reagent attaches to is already bonded to two other carbons, leading to a tri-substituted alcohol structure. Each type of carbonyl compound diversifies the alcohol output by varying the alkyl groups at the hydroxyl-bearing carbon .

You might also like