0% found this document useful (0 votes)
84 views7 pages

HSSC-II Maths MCQs on Differentiation

This document contains 26 multiple choice questions related to differentiation from a mathematics exam for grade HSSC-II. The questions cover topics like finding the derivative of various functions, determining the slope of tangent lines, and taking higher order derivatives. The full solutions are not shown, only the multiple choice options for each question.

Uploaded by

Isbah I
Copyright
© All Rights Reserved
We take content rights seriously. If you suspect this is your content, claim it here.
Available Formats
Download as PDF, TXT or read online on Scribd
0% found this document useful (0 votes)
84 views7 pages

HSSC-II Maths MCQs on Differentiation

This document contains 26 multiple choice questions related to differentiation from a mathematics exam for grade HSSC-II. The questions cover topics like finding the derivative of various functions, determining the slope of tangent lines, and taking higher order derivatives. The full solutions are not shown, only the multiple choice options for each question.

Uploaded by

Isbah I
Copyright
© All Rights Reserved
We take content rights seriously. If you suspect this is your content, claim it here.
Available Formats
Download as PDF, TXT or read online on Scribd

HAMZA ARMY PUBLIC SCHOOL & COLLEGE (B0YS)

MCQs MATHEMATICS HSSC-II


Unit # 2 Differentiation

1) At which of the following point the curve y = 𝑥 2 – 4x +3 has gradient -2?

A)(0,1) B) (1,0)
C) (2,1) D) (-3,2)
2) What we get, if we differentiate (1 + 𝑥 2 )𝑛 w.r.t 𝑥 2 ?
A) (1 + 𝑥 2 )𝑛−1 B) 2xn (1 + 𝑥 2 )𝑛−1
C) 2n(1 + 𝑥 2 )𝑛−1 D) xn(1 + 𝑥 2 )𝑛−1
2
3) What is the derivative of ln𝑒 (1+𝑥 ) ?
1
A) 𝑒 1 +𝑥2 B) 2x
2𝑥 2
C) 1 + 𝑥2 D) x. 𝑒 1 + 𝑥
𝑒
4) which of the following is linearity rule of differentiation?
𝑑 𝑑𝑓 𝑑 𝑑𝑔 𝑑𝑓
A) 𝑑𝑥(af) = a 𝑑𝑥 B) 𝑑𝑥 (𝑓𝑔) = f 𝑑𝑥 + g𝑑𝑥
𝑑 𝑑𝑓 𝑑𝑔 𝑑 𝑑𝑓
C) 𝑑𝑥( af + bg) = a 𝑑𝑥 + b 𝑑𝑥 D) 𝑑𝑥(af) = 𝑑𝑥
5) What is the slope of tangent line on a curve 𝑦 2 = 4𝑥 at point p (2, 2)?
A) -1 B) 1
C) 0 D) 2
𝑑𝑦 2 4
6) What is the value of 𝑑𝑥 , if x = 3a𝑡 + 2 and y = 3a𝑡 + 9 ?
2(𝑥 −2) 4𝑡
A) B)
3𝑎 𝑎
𝑎 6𝑎𝑡
C) 4𝑡 2 D) 25
7) What is the slope of tangent line to the circle 𝑥 2 + 𝑦 2 = 5x + 4y at a point (5,4)?
A) 1 B) 0
5 5
C) 4 D) − 4
𝑑𝑦
8) What is the value of , if 𝑥 2 𝑦 3 + 𝑦 3 = 12?
𝑑𝑥
2𝑥𝑦 −2𝑥𝑦
A) 3(𝑥 2 + 1) B) 3(𝑥 2 + 1)
−3(𝑥 2 + 1) 3(𝑥 2 + 1)
C) D)
2𝑥𝑦 2𝑥𝑦
9) What is the value of sin(sin(sinx)) ?
A) Cos(sin(sinx)) B) Cos(sin(sinx)).Cos(sinx).cosx
C) –Cos(sin(sinx)).Cos(sinx).Cosx D) Cos(sin(Sinx)).Cos(sinx).Cosx
10) What is the equation of normal of the curve y = sinx at( 𝜋, 0)?
A) x + y + 𝜋 = 0 B) x + y - 𝜋 = 0
C) x - y = 𝜋 D) x - y + 𝜋 =0
1 1
11) If √𝑥 + √𝑦 = 1 , then what is the slope of tangent to the curve at (4 , 4 ) ?
A) 1 B) 2
1
C) -1 D) 2
𝑑 3𝜋
12) What is the value of Cos ( )?
𝑑𝑥 2
3𝜋
A) –sin( 2 ) B) 1
C) -1 D) 0
𝑑 5
13) What is the value of 7(4 −3𝑥 ) ?
𝑑𝑥
5 5
A) -15𝑥 4 .74 −3𝑥 .ln7 B) -15𝑥 4 .7(4 −3𝑥 ).log10 7
5
C) (4-3𝑥 5 ).73 −3𝑥 D) 4 - 3𝑥 5
𝑑
14) What is the value of cos −1 4𝑥?
𝑑𝑥
−1 1
A) √1−16𝑥2
B) √1−16𝑥 2
4 −4
C) √1−16𝑥 2
D √1−16𝑥 2
𝑑
15) What is the value of 𝑑𝑥 (ln𝑥 𝑥 )?
A) lnx + 1 B) (lnx)𝑥
C) 𝑥 𝑥 .lsnx D) 𝑥 𝑥 𝑙𝑛(𝑒𝑥)
𝑑
16) What is the value Sinhx?
𝑑𝑥
𝑒 𝑥 + 𝑒 −𝑥 𝑒 𝑥 − 𝑒 −𝑥
A) B)
2 2
𝑒 2𝑥 + 𝑒 −2𝑥 𝑒 2𝑥 − 𝑒 −2𝑥
C) D)
2 2
1 1
17) What is the derivative of sin−1(2𝑥 2−1 ) w.r.t √𝑥 2 − 1 at x = 2 ?
A) – 4 B) 4
1
C) 8 D) 2
𝑑 1
18) What is the value of ?
𝑑𝑥 tan−1 𝑥
−1 1
A) B) (tan−1 𝑥)2
(tan−1 𝑥)2
1 −1
C) D) (tan−1 𝑥)2 (1 +𝑥 2 )
(tan−1 𝑥)2 (1 +𝑥 2 )
𝑑𝑦
19) What is the value of , if y=log10 (3𝑥 2 + 7)?
𝑑𝑥
1 6𝑥
A) 3𝑥 2 +7 B) 3𝑥 2 +7
6𝑥
C) D) 6x
(3𝑥 2 +7) ln 10
20) What is the value of 𝑦 (6) , If y = 4𝑥 5 + 180𝑥 4 -343𝑥 3 − 705𝑥 2 + 4?
A) 0 B) 120
C) 480 D) 720
21) What is the value of 𝑓 3 (x), if f(x) = 160𝑥 3 -700𝑥 2 +414x-331?
A) 960 B) 160
C) 480 D) 0
22) For f(x) = (3x + b)7 , what is the value of fifth derivative w.r.t ‘x’?
A) 612360(3x+b)5 B) 612360(3x + b)2
2
C) 2520(3x + b) D) 243(3x + b)2
1
23) If y = 𝑥+1 ,then what is the value of 𝑦 (𝑛) ?
(−1)𝑛 𝑛!𝑎𝑛 (−1)𝑛 𝑛!
A) (𝑎𝑥 + 𝑏)𝑛+1 B) (𝑥 + 1)𝑛+1
−1
C) (𝑥 + 1)𝑛 D) n!
24) What is the nth derivative of f(x) =ln (ax + b)?
(−1)𝑛−1 n! 𝑎𝑛 (−1)𝑛 (𝑛−1)!𝑎𝑛
A) B)
(𝑎𝑥 + 𝑏)𝑛 (𝑎𝑥 + 𝑏)𝑛
(−1)𝑛−1 (𝑛−1)! (−1)𝑛−1 (𝑛−1)!.𝑎𝑛
C) D)
(𝑎𝑥 + 𝑏)𝑛 (𝑎𝑥 + 𝑏)𝑛
3𝑥 th
25) If f(x) = 5 , then what is the value of 17 derivative?
A) 3.53𝑥 .ln5 B) 317 . 53𝑥 .ln5
C)317 . 53𝑥 (ln5)17 D) 317 . 53𝑥 . ( ln5)16
26) If f(x) =Sin3x, then what is the value of 99th derivate?
A) 399 .Sin3x B) -399 .Cos3x
C) 399 .Cos3x D) −399 .Sin3x
1
27) What is the value of 5th derivative of f(x) =4𝑥 + 3 ?
−45! .5! −45 .5!
A) (4𝑥 + 3)6 B) (4𝑥 + 3)6
5! −5!
C)(4𝑥 + 3)6 D) (4𝑥 + 3)6
28) If y = 𝑒 4𝑥 , then what is the value of 80th derivative?
A) 𝑒 4𝑥 B) 4𝑒 4𝑥
C) 480 𝑒 4𝑥 D) 48 𝑒 4𝑥
𝑑2 𝑦
29) If x= 1 + 𝑡 2 and y = 𝑡 3 + 2𝑡 2 +1, then what is the value of ?
𝑑𝑥 2
3 3
A)4𝑡 B) 4
−3 3
C) 4𝑡 D) − 4
𝑑2 𝑦
30) If x = aCos2t and y = bSin2t , then what is the value of ?
𝑑𝑥 2
𝑏 −𝑏
A) B)
𝑎2 .𝑠𝑖𝑛3 2𝑡 𝑎2 .𝑠𝑖𝑛3 2𝑡
−𝑏 𝑏
C) D) 𝑎2 .𝑐𝑜𝑠3 2𝑡
𝑎2 .𝐶𝑜𝑠3 2𝑡
𝑥2 𝑥3 𝑥4
31) Which of the following function has expansion 1 + x + + + +…….?
2! 3! 4!
A) 𝑒 −𝑥 B) 𝑒 𝑥
C) sinx D) Cosx
32) which of the following is Maclaurin’s expansion of Cosx?
𝑥2 𝑥4 𝑥3 𝑥5 𝑥7
A) 1 + x + + +……………….. B) x - + - +………
2! 4! 3! 5! 7!
𝑥2 𝑥3 𝑥2 𝑥4
C) 1 + x + 2! + 3! +………… D) 1 - 2! + 4! +………….
33) What is the equation of tangent to the curve y = 2lnx at x=e?
A) 2x-ey =0 B) x – ey + 1=0
C) x +ey + 1=0 D) x –e(1-y)=0
2 2 2 //
34) If 𝑥 + 𝑦 =𝑟 , then what is the value of 𝑦 ?
𝑟2 𝑦3
A) B) 𝑟 2
𝑦3
𝑟2 𝑦3
C) − 𝑦 3 D) − 𝑟 2

𝜋
35) What is the equation of normal to the curve y = Cos(x-𝜋) at x = 2
𝜋
A) y =- x - B) 2x+2y-π=0
2
𝜋
C) x+y+π=0 D) x –y+ 2 =0
1
36) Which of the following is Maclaurin’s Series expansion for f(x) = 1 + 𝑥 ?
𝑥2 𝑥3
A) 1 - x + 2! − 3! +……………….. B) 1-x +𝑥 2 -𝑥 3 +………
C) 1 + x + 𝑥 2 + 𝑥 3 +….. D) 1-x-𝑥 2 − 𝑥 3 -……..
37)In which of the following interval f(x) =-5 𝑥 2 -10x-5 is increasing?
A) (-1,∞) B) (-∞,-1)
C) (-∞, +∞) D) (-1,1)
38) which of the following is a point of inflection for the function f(x) =𝑥 3 -6𝑥 2 +9x+1?
A) (2,3) B) (0,3)
C) (-2,3) D) (6,3)
2 2
39) What is the equation of tangent line to the curve x +y =13 at (-2,3)?
A) 2x-3y-13=0 B) 2x-3y+13=0
C) 2x-3y=0 D) x-3y+13=0
𝑑
40) What is the value of 𝑑𝑥 (log 7 𝑥)?

A) A) 7x ln7 1
B)
x. ln7
1 1
C) D)
x x. ln10

41) If given that g(0)=2 ,𝑔/ (0)=1 and f(x)=x.g(x),then what is the value of 𝑓 / (0)?

A) -2 B) 0

B) 2 1
𝐷)
2

42) What is the geometrical meaning of the derivative of function y=f(x)?


A) Slope of the normal B) Slope of the tangent
C) 𝑠𝑙𝑜𝑝𝑒 𝑜𝑓 𝑡ℎ𝑒 𝑠𝑒𝑐𝑎𝑛𝑡 D) Inclination of the tangent

𝑑
43) What is the value of ( 𝑠𝑖𝑛𝑥, 𝑐𝑜𝑠𝑒𝑐𝑥)?
𝑑𝑥
A) 0 B) Sin2x
C) 1 D) -1

𝑑𝑦
44) If y= sin(sin(sinb)),where b is a constant ,then what is the value of ?
𝑑𝑥
A) Cos[cos(cosb)] B) b
C) 0 D) –sin[cos(cosb)]

45) A point where a function changes from an increasing function to a decreasing one is called a
point of_____________.
A) 𝑀𝑖𝑛𝑖𝑚𝑢𝑚 𝑣𝑎𝑙𝑢𝑒 𝑜𝑓 𝑓 B) 𝑀𝑎𝑥𝑖𝑚𝑢𝑚 𝑣𝑎𝑙𝑢𝑒 𝑜𝑓 𝑓
C) 𝑖𝑛𝑓𝑙𝑒𝑐𝑡𝑖𝑜𝑛 D) tangency
𝑑𝑦 1
46) What is the value of 𝑑𝑥 [𝑔(𝑥)] ,when g(x)≠ 0?
A) – 𝑔/ (x) B) 0

C) 𝑔/ (x) D)
−𝑔/ (𝑥)
[𝑔(𝑥)]2
2/3 /
47If f(x)=x ,then what is the value of 𝑓 (x) at x=8 ?
1
A) 8 B) 8
1 2
C) D)
3 3

𝑥 4 +3𝑥 2
48) What is the derivative of ?
2𝑥
3𝑥 2 +3 𝑥 4 +6𝑥 2
A) B)
2 8

4𝑥 3 +5𝑥 4𝑥 3 +6𝑥
C) D)
5 2
49) If f(x)=ax2-3x-5 and f/(2)=9 ,then what is the value of a?
A) 2 B) 3

C) -2 D) 4

1 𝑑𝑦
50) If y= 1+𝑢2 ,u=2x+1 then what is the value of 𝑑𝑥 at x=0”?
A) 1 B) -1

C) 2 D) 0

𝑑𝑦
51)
If y=√𝑥 + √𝑥 , then what is the value of 𝑑𝑥 ?
2√𝑥+1 4√𝑥+1
A) B)
4√𝑥√𝑥+√𝑥 4√𝑥−1
4√𝑥 4√𝑥−1
C) D)
2√𝑥+1 4√𝑥+1

𝜋
52)
If f(x)=xcotx ,then what is the value of 𝑓 / (4 )?
1
A) 1 − 2𝜋 B) 𝜋 − 2

𝜋 3𝜋
C) 1 − 2 D) 2

53) 𝑑
What is the value of 𝑑𝑥 (𝑐𝑜𝑠√𝑥 )?
− sin √𝑥 2𝑡𝑎𝑛𝑥
A) B) √2𝑡𝑎𝑛2 𝑥
2√𝑥

2√𝑥 𝑠𝑖𝑛√𝑥
C) D)
√2𝑐𝑜𝑠𝑥 2√2

𝑑
54) ( (1+x2) 𝑑𝑥 (tan−1 𝑥 − cot −1 𝑥)=?
A) -1 B) 0

C) 1 D) 2

𝑑
55) 2√tan 𝑥 𝑑𝑥 √tan 𝑥=?
1 B) 0
A) 𝑠𝑒𝑐 2 𝑥
2√𝑡𝑎𝑛𝑥

C) Sec2x D) √𝑡𝑎𝑛𝑥
56) If f(x)=-sinx ,then what is the value of 𝑓 ′′′ (cos −1 𝑥)?
A) x B) cosx

C) sinx D) –x

57) Which of the following is an expansion of ln(1 + 𝑥)?


𝑥3 𝑥5 𝑥7 𝑥2 𝑥4 𝑥6
A) x − + − +⋯ B) 1 − + − +⋯
3! 5! 7! 2! 4! 6!

𝑥2 𝑥3 𝑥4 𝑥2 𝑥3 𝑥4
C) −x − − − +⋯ D) x − + − +⋯
2 3 4 2 3 4

58) The minimum value of the function f(x)=x2 -x-2 is ____________


9 9
A) − 2 B) − 4

C) -1 D) 0

59) At which of the following value of the x, function f(x)=3x2 has minimum value?
A) 𝑥 = 3 B) 𝑥 = 2

C) x=1 D) 𝑥 = 0
60) If f/(x)=0 then f has relative maximum at x=c if:
A) 𝑓 ′′ (𝑐) > 0 B) 𝑓"(𝑐) < 0

C) 𝑓"(𝑐) = 0 D) 𝑓"(𝑐) ≥ 0
HSSC-II
Mathematics
Answer Keys
Unit # 2: Differentiation

1. B 16. B 31.B 46.B


2. C 17. C 32.B 47.D
3. B 18.D 33.D 48.C
4. C 19.C 34.A 49.A
5. B 20.A 35.B 50.B
6. A 21.A 36.B 51.A
7. C 22.A 37.B 52.C
8. B 23.B 38.B 53.A
9. B 24.B 39.A 54.D
10. C 25.C 40.B 55.C
11. A 26.D 41.B 56.A
12. D 27.B 42.C 57.D
13. A 28.C 43.B 58.A
14. C 29.A 44.A 59.D
15. A 30.B 45.C 60 B

Common questions

Powered by AI

In parametric equations, the second derivative with respect to x captures the acceleration or changes in the rate of change of y with respect to x. For x = 1 + t^2 and y = t^3 + 2t^2 + 1, differentiate both x and y with respect to t to find dx/dt = 2t and dy/dt = 3t^2 + 4t. Then, compute dy/dx = dy/dt / dx/dt = (3t^2 + 4t) / (2t). To find the second derivative d²y/dx², differentiate d(dy/dx)/dt and then divide by dx/dt, with the result being -3/4t. This value tells us how the rate of change itself is changing in terms of t .

The rule of linearity in differentiation is applied when differentiating linear combinations of functions. This rule states that the derivative of a sum of functions is the sum of their derivatives. It is extremely beneficial because it allows for the simplification of complex expressions, enabling easier computation by treating each function in the combination separately. This property ensures that differentiation is a linear operation, which maintains the structure of linear polynomial-like expressions during differentiation .

Linear combinations of derivatives allow for the construction of solutions to both ordinary and partial differential equations by leveraging superposition. This is foundational in physics where systems often obey linear laws, meaning solutions can be expressed as the sum of particular and homogeneous solutions, significantly simplifying the computational complexity. This framework enables the assembly of complex systems from simpler, solvable components, essential in fields like quantum mechanics and electromagnetism where equations dictate system behavior at fundamental levels .

The derivative of a function, denoted as dy/dx, provides the rate of change of the function with respect to x, which is mathematically equivalent to the slope of the tangent to the curve at any given point. The derivative essentially captures how the function behaves as it changes infinitesimally, hence allowing for precise contact with the tangent line .

To determine the slope of the tangent line at a specific point where the gradient is -2 for the curve y = x^2 − 4x + 3, you begin by finding the derivative of the function: dy/dx = 2x - 4. Set the derivative equal to -2: 2x - 4 = -2. Solve for x to get x = 1. Substitute x = 1 back into the original equation to find the corresponding y-value, which is y = 0. Therefore, the point is (1,0), where the tangent line has a slope of -2 .

Derivative relationships are crucial in determining the extrema of a function, where the first derivative test involves finding critical points where the derivative is zero or undefined. Evaluating the second derivative at these points helps classify the type of extrema: if f''(c) > 0, it's a local minimum, indicating concavity upwards, whereas f''(c) < 0 indicates a local maximum with concavity downwards. A zero second derivative suggests an inflection point, needing further investigation to classify the point correctly .

A point of inflection is a point on a curve where the sign of the curvature (second derivative) changes, indicating a transition between the curve bending upwards and downwards. On the other hand, a maximum or minimum point, determined by the first derivative being zero, represents a peak or trough in the function where the direction of increase or decrease changes, but the curvature sign (second derivative) does not necessarily change .

To compute the derivative of y = sin^(-1)(1/(2x^2-1)) at x=1/2, use the chain rule along with the derivative of the inverse sine function. Differentiating, dy/dx = 1/√(1-u^2) ⋅ du/dx, where u = 1/(2x^2-1). Substituting x = 1/2, the derivative evaluates and simplifies to give the slope of the function at the point, which is 8. This result indicates that the function’s rate of change is quite steep at x = 1/2, reflecting significant sensitivity to x at this point .

To obtain the fifth derivative of the function f(x) = (3x + b)^7, apply the generalized power rule repeatedly or use symbolic differentiation software. The process would involve differentiating iteratively, each time multiplying by the coefficient from the expansion. The fifth derivative is given by 612360(3x + b)^2. Computing such derivatives is useful in Taylor series expansion, where higher-order terms can approximate the function behavior around a point, providing insights into local curvature and behavior patterns .

The Maclaurin series approximates any function that can be expanded around zero by using the function's derivatives evaluated at that point. For e^x, it converges to its Taylor series expansion: 1 + x + x^2/2! + x^3/3! + ..., providing a polynomial approximation that becomes increasingly accurate as more terms are included. This is highly significant in computational mathematics and engineering, as it allows transcendental functions to be approximated by polynomials, significantly simplifying numerical calculations and solving of differential equations .

You might also like