Perfect Plan B
Learn, grow and become leaders of tomorrow
Problem 1 : Python Program to add two numbers
Example:
Input: num1 = 5, num2 = 3
Output: 8
Input: num1 = 13, num2 = 6
Output: 19
Solution 1 : Python Program to add two numbers
# Python3 program to add two numbers
num1 = 15
num2 = 12
# Adding two nos
sum = num1 + num2
# printing values
print("Sum of {0} and {1} is {2}" .format(num1, num2, sum))
Solution 2 : Python Program to add two numbers
# Python3 program to add two numbers
number1 = input("First number: ")
number2 = input("\nSecond number: ")
# Adding two numbers
# User might also enter float numbers
sum = float(number1) + float(number2)
# Display the sum
# will print value in float
print("The sum of {0} and {1} is {2}" .format(number1, number2, sum))
Problem 2 : Python Program for factorial of a number
Solution 1 : Python Program for factorial of a
number (Iterative)
# Python 3 program to find
# factorial of given number
def factorial(n):
if n < 0:
return 0
elif n == 0 or n == 1:
return 1
else:
fact = 1
while(n > 1):
fact *= n
n -= 1
return fact
# Driver Code
num = 5;
print("Factorial of",num,"is",
factorial(num))
Solution 2 : Python Program for factorial of a
number (Recursive)
# Python 3 program to find
# factorial of given number
def factorial(n):
# single line to find factorial
return 1 if (n==1 or n==0) else n * factorial(n - 1);
# Driver Code
num = 5;
print("Factorial of",num,"is",
factorial(num))
Solution 3 : Python Program for factorial of a
number
# Python 3 program to find
# factorial of given number
def factorial(n):
# single line to find factorial
return 1 if (n==1 or n==0) else n * factorial(n - 1)
# Driver Code
num = 5
print ("Factorial of",num,"is",
factorial(num))
Problem 3 : Python Program for simple interest
Simple interest formula is given by:
EXAMPLE1:
Input : P = 10000
Simple Interest = (P x T x R)/100
R = 5
T = 5
Where, Output :2500
We need to find simple interest on
P is the principle amount Rs. 10,000 at the rate of 5% for 5
units of time.
T is the time and
EXAMPLE2:
R is the rate Input : P = 3000
R = 7
T = 1
Output :210
Solution : Python Program for simple interest
# Python3 program to find simple interest
# for given principal amount, time and
# rate of interest.
def simple_interest(p,t,r):
print('The principal is', p)
print('The time period is', t)
print('The rate of interest is',r)
si = (p * t * r)/100
print('The Simple Interest is', si)
return si
# Driver code
simple_interest(8, 6, 8)
Problem 4 : Python Program for compound interest
Formula to calculate compound
Input : Principle (amount): 1200
interest annually is given by: Time: 2
Rate: 5.4
Output : Compound Interest =
Compound Interest = P(1 + R/100) t 1333.099243
Where,
P is principle amount
R is the rate and
T is the time span
Solution : Python Program for compound interest
# Python3 program to find compound
# interest for given values.
def compound_interest(principle, rate, time):
# Calculates compound interest
CI = principle * (pow((1 + rate / 100), time))
print("Compound interest is", CI)
# Driver Code
compound_interest(10000, 10.25, 5)
Problem 5 : Python Program to check Armstrong
Number
Input : 153
Output : Yes
153 is an Armstrong number.
1*1*1 + 5*5*5 + 3*3*3 = 153
Input : 120
Output : No
120 is not a Armstrong number.
1*1*1 + 2*2*2 + 0*0*0 = 9
Input : 1253
Output : No
1253 is not a Armstrong Number
1*1*1*1 + 2*2*2*2 + 5*5*5*5 + 3*3*3*3 =
723
Input : 1634
Output : Yes
1*1*1*1 + 6*6*6*6 + 3*3*3*3 + 4*4*4*4 =
1634
Solution : Python Program to check Armstrong Number
# Python program to determine whether the # Function to check whether the given
number is number is
# Armstrong number or not # Armstrong number or not
def isArmstrong (x):
# Function to calculate x raised to the power y n = order(x)
def power(x, y): temp = x
if y==0: sum1 = 0
return 1 while (temp!=0):
if y%2==0: r = temp%10
return power(x, y/2)*power(x, y/2) sum1 = sum1 + power(r, n)
return x*power(x, y/2)*power(x, y/2) temp = temp/10
# Function to calculate order of the number # If condition satisfies
def order(x): return (sum1 == x)
# variable to store of the number
n=0 # Driver Program
while (x!=0): x = 153
n = n+1 print(isArmstrong(x))
x = x/10 x = 1253
return n print(isArmstrong(x))
Problem 6 : Python Program for Program to find area
of a circle
Area = pi * r2
where r is radius of circle
Solution : Python Program for Program to find area
of a circle
# Python program to find Area of a circle
def findArea(r):
PI = 3.142
return PI * (r*r);
# Driver method
print("Area is %.6f" % findArea(5));
Problem 7 : Python program to print all Prime
numbers in an Interval
Given two positive integer start and end. The task is
to write a Python program to print all Prime numbers
in an Interval.
Definition: A prime number is a natural number
greater than 1 that has no positive divisors other than
1 and itself. The first few prime numbers are {2, 3, 5, 7,
11, ….}.
Solution : Python program to print all Prime
numbers in an Interval
# Python program to print all
# prime number in an interval
start = 11
end = 25
for val in range(start, end + 1):
if val > 1:
for n in range(2, val//2 + 2):
if (val % n) == 0:
break
else:
if n == val//2 + 1:
print(val)
Problem 8 : Python program to check whether a
number is Prime or not
Definition: A prime number is a natural number greater than 1 that has no
positive divisors other than 1 and itself. The first few prime numbers are {2, 3,
5, 7, 11, ….}.
Input: n = 11
Output: true
Input: n = 15
Output: false
Solution : Python program to check whether a
number is Prime or not
# Python program to check if
# given number is prime or not
num = 11
# If given number is greater than 1
if num > 1:
# Iterate from 2 to n / 2
for i in range(2, num//2):
# If num is divisible by any number between
# 2 and n / 2, it is not prime
if (num % i) == 0:
print(num, "is not a prime number")
break
else:
print(num, "is a prime number")
else:
print(num, "is not a prime number")
Solution : Python program to check whether a
number is Prime or not
# A optimized school method based
# Python3 program to check i=5
# if a number is prime while(i * i <= n) :
if (n % i == 0 or n % (i + 2) == 0) :
return False
i=i+6
def isPrime(n) :
return True
# Corner cases
if (n <= 1) :
return False # Driver Program
if (n <= 3) : if (isPrime(11)) :
return True print(" true")
else :
print(" false")
# This is checked so that we can
skip if(isPrime(15)) :
# middle five numbers in below print(" true")
loop else :
if (n % 2 == 0 or n % 3 == 0) : print(" false")
return False
Problem 9 : Python Program for n-th Fibonacci
number
In mathematical terms, the sequence Fn of Fibonacci numbers is
defined by the recurrence relation
Fn = Fn-1 + Fn-2
with seed values
F0 = 0 and F1 = 1.
Hint : Recursion
Solution : Python Program for n-th Fibonacci
number
# Function for nth Fibonacci number
def Fibonacci(n):
if n<0:
print("Incorrect input")
# First Fibonacci number is 0
elif n==1:
return 0
# Second Fibonacci number is 1
elif n==2:
return 1
else:
return Fibonacci(n-1)+Fibonacci(n-2)
# Driver Program
print(Fibonacci(9))
Solution : Python Program for n-th Fibonacci
number
# Function for nth fibonacci number - Dynamic Programing
# Taking 1st two fibonacci nubers as 0 and 1
FibArray = [0,1]
def fibonacci(n):
if n<0:
print("Incorrect input")
elif n<=len(FibArray):
return FibArray[n-1]
else:
temp_fib = fibonacci(n-1)+fibonacci(n-2)
[Link](temp_fib)
return temp_fib
# Driver Program
print(fibonacci(9))
Solution : Python Program for n-th Fibonacci
number
# Function for nth fibonacci number - Space Optimisataion
# Taking 1st two fibonacci numbers as 0 and 1
def fibonacci(n):
a=0
b=1
if n < 0:
print("Incorrect input")
elif n == 0:
return a
elif n == 1:
return b
else:
for i in range(2,n):
c=a+b
a=b
b=c
return b
# Driver Program
print(fibonacci(9))
Problem 10 : Python Program for printing Fibonacci
numbers
In mathematical terms, the sequence Fn of Fibonacci numbers is
defined by the recurrence relation
Fn = Fn-1 + Fn-2
with seed values
F0 = 0 and F1 = 1.
Hint : Recursion
Solution : Python Program for printing Fibonacci
numbers
# Function for nth Fibonacci number
def Fibonacci(n):
if n<0:
print("Incorrect input")
# First Fibonacci number is 0
elif n==1:
return 0
# Second Fibonacci number is 1
elif n==2:
return 1
else:
return Fibonacci(n-1)+Fibonacci(n-2)
# Driver Program
print(Fibonacci(9))
Solution : Python Program for printing Fibonacci
numbers
# Function for nth fibonacci number - Dynamic Programing
# Taking 1st two fibonacci nubers as 0 and 1
FibArray = [0,1]
def fibonacci(n):
if n<0:
print("Incorrect input")
elif n<=len(FibArray):
return FibArray[n-1]
else:
temp_fib = fibonacci(n-1)+fibonacci(n-2)
[Link](temp_fib)
return temp_fib
# Driver Program
print(fibonacci(9))
Solution : Python Program for printing Fibonacci
numbers
# Function for nth fibonacci number - Space Optimisataion
# Taking 1st two fibonacci numbers as 0 and 1
def fibonacci(n):
a=0
b=1
if n < 0:
print("Incorrect input")
elif n == 0:
return a
elif n == 1:
return b
else:
for i in range(2,n):
c=a+b
a=b
b=c
return b
# Driver Program
print(fibonacci(9))
Problem 11 : Python Program for How to check if a
given number is Fibonacci number?
Input : 8
Output : Yes
Input : 34
Output : Yes
Input : 41
Output : No
Solution : Python Program for How to check if a
given number is Fibonacci number?
# python program to check if x is a perfect square
import math
# A utility function that returns true if x is perfect square
def isPerfectSquare(x):
s = int([Link](x))
return s*s == x
# Returns true if n is a Fibinacci Number, else false
def isFibonacci(n):
# n is Fibinacci if one of 5*n*n + 4 or 5*n*n - 4 or both
# is a perferct square
return isPerfectSquare(5*n*n + 4) or isPerfectSquare(5*n*n - 4)
# A utility function to test above functions
for i in range(1,11):
if (isFibonacci(i) == True):
print i,"is a Fibonacci Number"
else:
print i,"is a not Fibonacci Number "
Problem 12 : Program to print ASCII Value of a
character
Input : a
Output : 97
Input : D
Output : 68
Solution : Program to print ASCII Value of a character
# Python program to print
# ASCII Value of Character
# In c we can assign different
# characters of which we want ASCII value
c = 'g'
# print the ASCII value of assigned character in c
print("The ASCII value of '" + c + "' is", ord(c))
Problem 13 : Python Program for Sum of squares of
first n natural numbers
Input : N = 4
Output : 30
= 1 + 4 + 9 + 16
= 30
Input : N = 5
Output : 55
Solution : Python Program for Sum of squares of
first n natural numbers
# Python3 Program to
# find sum of square
# of first n natural
# numbers
# Return the sum of
# square of first n
# natural numbers
def squaresum(n) :
# Iterate i from 1
# and n finding
# square of i and
# add to sum.
sm = 0
for i in range(1, n+1) :
sm = sm + (i * i)
return sm
# Driven Program
n=4
print(squaresum(n))
Solution : Python Program for Sum of squares of
first n natural numbers
# Python3 Program to
# find sum of square
# of first n natural
# numbers
# Return the sum of
# square of first n
# natural numbers
def squaresum(n) :
return (n * (n + 1) * (2 * n + 1)) // 6
# Driven Program
n=4
print(squaresum(n))
Solution : Python Program for Sum of squares of
first n natural numbers
# Python Program to find sum of square of first
# n natural numbers. This program avoids
# overflow upto some extent for large value
# of n.y
def squaresum(n):
return (n * (n + 1) / 2) * (2 * n + 1) / 3
# main()
n=4
print(squaresum(n));
Problem 14 : Python Program for cube sum of first n
natural numbers
Input : n = 5
Output : 225
13 + 23 + 33 + 43 + 53 = 225
Input : n = 7
Output : 784
13 + 23 + 33 + 43 + 53 +
63 + 73 = 784
Solution : Python Program for cube sum of first n
natural numbers
# Simple Python program to find sum of series
# with cubes of first n natural numbers
# Returns the sum of series
def sumOfSeries(n):
sum = 0
for i in range(1, n+1):
sum +=i*i*i
return sum
# Driver Function
n=5
print(sumOfSeries(n))
Solution : Python Program for cube sum of first n
natural numbers
# A formula based Python program to find sum
# of series with cubes of first n natural
# numbers
# Returns the sum of series
def sumOfSeries(n):
x = (n * (n + 1) / 2)
return (int)(x * x)
# Driver Function
n=5
print(sumOfSeries(n))
Solution : Python Program for cube sum of first n
natural numbers
# Efficient Python program to find sum of cubes
# of first n natural numbers that avoids
# overflow if result is going to be within
# limits.
# Returns the sum of series
def sumOfSeries(n):
x=0
if n % 2 == 0 :
x = (n/2) * (n+1)
else:
x = ((n + 1) / 2) * n
return (int)(x * x)
# Driver Function
n=5
print(sumOfSeries(n))
Slack Invite Link
[Link]
ared_invite/zt-drplefyv-x1vurrlFy98UOe1
irCfLXw
Social Media Links
Facebook: [Link]
Twitter: [Link]
Linkedin: [Link]
Instagram: [Link]
Quora:
[Link]
R3y0
Youtube: [Link]